C6H7N4S+ — CID 14075751
1-methyl-5H-[1,2,4]triazolo[1,5-b]pyridazin-1-ium-6-thione (PubChem CID 14075751) has the molecular formula C6H7N4S+ and a molecular weight of 167.22 g/mol. Its IUPAC name is 1-methyl-5H-[1,2,4]triazolo[1,5-b]pyridazin-1-ium-6-thione.
| Compound Name | 1-methyl-5H-[1,2,4]triazolo[1,5-b]pyridazin-1-ium-6-thione |
|---|---|
| PubChem CID | 14075751 |
| Molecular Formula | C6H7N4S+ |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 1-methyl-5H-[1,2,4]triazolo[1,5-b]pyridazin-1-ium-6-thione |
| SMILES | C[n+]1cnn2[nH]c(=S)ccc21 |
| InChI | InChI=1S/C6H6N4S/c1-9-4-7-10-6(9)3-2-5(11)8-10/h2-4H,1H3/p+1 |
| InChIKey | FPDUIRWNBARFFW-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|