C6H4N6 — CID 12603845
1,3,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 12603845) has the molecular formula C6H4N6 and a molecular weight of 160.14 g/mol. Its IUPAC name is 1,3,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 1,3,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 12603845 |
| Molecular Formula | C6H4N6 |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1,3,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | c1nc2n(ccc3ncnn32)n1 |
| InChI | InChI=1S/C6H4N6/c1-2-11-6(8-4-9-11)12-5(1)7-3-10-12/h1-4H |
| InChIKey | JCNNWCHWXHRIKI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |