C9H15N3 — CID 143195786
1,5-bis(ethenyl)-1,2,4-triazole;propane (PubChem CID 143195786) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,5-bis(ethenyl)-1,2,4-triazole;propane.
| Compound Name | 1,5-bis(ethenyl)-1,2,4-triazole;propane |
|---|---|
| PubChem CID | 143195786 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,5-bis(ethenyl)-1,2,4-triazole;propane |
| SMILES | C=Cc1ncnn1C=C.CCC |
| InChI | InChI=1S/C6H7N3.C3H8/c1-3-6-7-5-8-9(6)4-2;1-3-2/h3-5H,1-2H2;3H2,1-2H3 |
| InChIKey | QBEDYSRPBIFDEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |