C8H8N6S — CID 15618575
7-methyl-5-methylsulfanyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene (PubChem CID 15618575) has the molecular formula C8H8N6S and a molecular weight of 220.26 g/mol. Its IUPAC name is 7-methyl-5-methylsulfanyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 7-methyl-5-methylsulfanyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 15618575 |
| Molecular Formula | C8H8N6S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 7-methyl-5-methylsulfanyl-1,3,4,6,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,4,7,9,11-pentaene |
| SMILES | CSc1nnc2n1c(C)cc1nncn12 |
| InChI | InChI=1S/C8H8N6S/c1-5-3-6-10-9-4-13(6)7-11-12-8(15-2)14(5)7/h3-4H,1-2H3 |
| InChIKey | VFSKMNCNWMXFLI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |