C25H27FN4O — CID 124908601
11-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-ethyl-5-(4-fluorophenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 124908601) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is 11-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-ethyl-5-(4-fluorophenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-ethyl-5-(4-fluorophenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 124908601 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 11-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-ethyl-5-(4-fluorophenyl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCc1nn2c(ncc3c(=O)n([C@@H]4CCC[C@@H](C)[C@H]4C)ccc32)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN4O/c1-4-20-23(17-8-10-18(26)11-9-17)24-27-14-19-22(30(24)28-20)12-13-29(25(19)31)21-7-5-6-15(2)16(21)3/h8-16,21H,4-7H2,1-3H3/t15-,16-,21-/m1/s1 |
| InChIKey | RAMFASYYRUIAST-WHSLLNHNSA-N |
| XLogP | 5.41 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |