C23H31N5O3 — CID 124911069
(1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 124911069) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 124911069 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | C[C@@]12CC[C@@H](C[C@@H]1C(=O)NCCCN1CCCC1=O)[C@@]1(C2)NC(=O)c2cccnc2N1 |
| InChI | InChI=1S/C23H31N5O3/c1-22-8-7-15(23(14-22)26-19-16(20(30)27-23)5-2-9-24-19)13-17(22)21(31)25-10-4-12-28-11-3-6-18(28)29/h2,5,9,15,17H,3-4,6-8,10-14H2,1H3,(H,24,26)(H,25,31)(H,27,30)/t15-,17+,22-,23+/m0/s1 |
| InChIKey | HOAPDDJDVGCSKP-OULKIGNDSA-N |
| XLogP | 1.89 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|