C22H32O6 — CID 124911206
(1R,2S,5S,6R,9S,10S,13R,18R)-13-hydroxy-6-(2-hydroxyacetyl)-18-methoxy-5-methyl-19-oxapentacyclo[8.7.2.01,13.02,10.05,9]nonadecan-15-one (PubChem CID 124911206) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (1R,2S,5S,6R,9S,10S,13R,18R)-13-hydroxy-6-(2-hydroxyacetyl)-18-methoxy-5-methyl-19-oxapentacyclo[8.7.2.01,13.02,10.05,9]nonadecan-15-one.
| Compound Name | (1R,2S,5S,6R,9S,10S,13R,18R)-13-hydroxy-6-(2-hydroxyacetyl)-18-methoxy-5-methyl-19-oxapentacyclo[8.7.2.01,13.02,10.05,9]nonadecan-15-one |
|---|---|
| PubChem CID | 124911206 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (1R,2S,5S,6R,9S,10S,13R,18R)-13-hydroxy-6-(2-hydroxyacetyl)-18-methoxy-5-methyl-19-oxapentacyclo[8.7.2.01,13.02,10.05,9]nonadecan-15-one |
| SMILES | CO[C@@H]1O[C@]23CC[C@@]4(O)CC(=O)CC[C@]14[C@@H]2CC[C@]1(C)[C@H](C(=O)CO)CC[C@@H]13 |
| InChI | InChI=1S/C22H32O6/c1-19-7-6-17-21-8-5-13(24)11-20(21,26)9-10-22(17,28-18(21)27-2)16(19)4-3-14(19)15(25)12-23/h14,16-18,23,26H,3-12H2,1-2H3/t14-,16-,17-,18+,19+,20+,21-,22-/m0/s1 |
| InChIKey | KBOHKNKCARNXLE-OREHGWOGSA-N |
| XLogP | 2.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |