C19H29N3O2 — CID 124911750
(3R,3aR,7aS)-3-(pyridin-4-ylmethoxy)-1-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 124911750) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-(pyridin-4-ylmethoxy)-1-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3R,3aR,7aS)-3-(pyridin-4-ylmethoxy)-1-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 124911750 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (3R,3aR,7aS)-3-(pyridin-4-ylmethoxy)-1-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1cc(CO[C@@H]2CN(CCN3CCCC3)[C@H]3CCCO[C@@H]23)ccn1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-10-21(9-1)11-12-22-14-18(19-17(22)4-3-13-23-19)24-15-16-5-7-20-8-6-16/h5-8,17-19H,1-4,9-15H2/t17-,18+,19+/m0/s1 |
| InChIKey | SVHFJEBVLWKHBT-IPMKNSEASA-N |
| XLogP | 1.93 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |