C20H28N4O — CID 124913707
(7R)-5-(2-phenylmethoxyethyl)-7-(pyrrolidin-1-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 124913707) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (7R)-5-(2-phenylmethoxyethyl)-7-(pyrrolidin-1-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | (7R)-5-(2-phenylmethoxyethyl)-7-(pyrrolidin-1-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 124913707 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (7R)-5-(2-phenylmethoxyethyl)-7-(pyrrolidin-1-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | c1ccc(COCCN2Cc3ccnn3[C@H](CN3CCCC3)C2)cc1 |
| InChI | InChI=1S/C20H28N4O/c1-2-6-18(7-3-1)17-25-13-12-23-14-19-8-9-21-24(19)20(16-23)15-22-10-4-5-11-22/h1-3,6-9,20H,4-5,10-17H2/t20-/m1/s1 |
| InChIKey | DHHHSRVPBNWULF-HXUWFJFHSA-N |
| XLogP | 2.55 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|