C20H26N4O3 — CID 131654610
morpholin-4-yl-[5-(2-phenylmethoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 131654610) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is morpholin-4-yl-[5-(2-phenylmethoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | morpholin-4-yl-[5-(2-phenylmethoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 131654610 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | morpholin-4-yl-[5-(2-phenylmethoxyethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | O=C(C1CN(CCOCc2ccccc2)Cc2ccnn21)N1CCOCC1 |
| InChI | InChI=1S/C20H26N4O3/c25-20(23-9-12-26-13-10-23)19-15-22(14-18-6-7-21-24(18)19)8-11-27-16-17-4-2-1-3-5-17/h1-7,19H,8-16H2 |
| InChIKey | MIDPMHIKWHOPCP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|