C24H28O6 — CID 124914804
diethyl 2-[(1R,2S,3S,4R,5S,7R,9R,11R,12R,15S)-6,10-dioxo-8-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadecanyl]propanedioate (PubChem CID 124914804) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is diethyl 2-[(1R,2S,3S,4R,5S,7R,9R,11R,12R,15S)-6,10-dioxo-8-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadecanyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2S,3S,4R,5S,7R,9R,11R,12R,15S)-6,10-dioxo-8-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadecanyl]propanedioate |
|---|---|
| PubChem CID | 124914804 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | diethyl 2-[(1R,2S,3S,4R,5S,7R,9R,11R,12R,15S)-6,10-dioxo-8-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadecanyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1[C@@H]2C(=O)[C@@H]3[C@@H]4C5C6[C@@H](CC[C@@H]63)[C@H]3C(=O)[C@@H]1[C@@H]([C@@H]53)[C@H]42 |
| InChI | InChI=1S/C24H28O6/c1-3-29-23(27)20(24(28)30-4-2)17-18-15-13-10(21(18)25)7-5-6-8-9(7)12(13)14-11(8)22(26)19(17)16(14)15/h7-20H,3-6H2,1-2H3/t7-,8+,9?,10-,11+,12?,13-,14-,15+,16+,17?,18-,19-/m1/s1 |
| InChIKey | MKFVYQPUKYMICH-DKINMDPPSA-N |
| XLogP | 1.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|