C21H20F3N5O3S — CID 1249161
furan-2-yl-[4-[(5S,7R)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazin-1-yl]methanone (PubChem CID 1249161) has the molecular formula C21H20F3N5O3S and a molecular weight of 479.48 g/mol. Its IUPAC name is furan-2-yl-[4-[(5S,7R)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(5S,7R)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1249161 |
| Molecular Formula | C21H20F3N5O3S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | furan-2-yl-[4-[(5S,7R)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2cnn3c2N[C@H](c2cccs2)C[C@@H]3C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H20F3N5O3S/c22-21(23,24)17-11-14(16-4-2-10-33-16)26-18-13(12-25-29(17)18)19(30)27-5-7-28(8-6-27)20(31)15-3-1-9-32-15/h1-4,9-10,12,14,17,26H,5-8,11H2/t14-,17+/m0/s1 |
| InChIKey | XBNTYHSPJKEXML-WMLDXEAASA-N |
| XLogP | 3.80 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |