C26H36NO2+ — CID 124916524
1-[(3R,8R,9R,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-pyridin-1-ium-1-ylethanone (PubChem CID 124916524) has the molecular formula C26H36NO2+ and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-[(3R,8R,9R,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-pyridin-1-ium-1-ylethanone.
| Compound Name | 1-[(3R,8R,9R,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-pyridin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 124916524 |
| Molecular Formula | C26H36NO2+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-[(3R,8R,9R,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-pyridin-1-ium-1-ylethanone |
| SMILES | C[C@]12CC[C@@H]3[C@H](CC=C4C[C@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C26H36NO2/c1-25-12-10-19(28)16-18(25)6-7-20-21-8-9-23(26(21,2)13-11-22(20)25)24(29)17-27-14-4-3-5-15-27/h3-6,14-15,19-23,28H,7-13,16-17H2,1-2H3/q+1/t19-,20-,21+,22-,23-,25+,26+/m1/s1 |
| InChIKey | JCXKLDMPWBYJSG-DKFDVFDGSA-N |
| XLogP | 4.48 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|