C21H31BrO2 — CID 74034635
2-bromo-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 74034635) has the molecular formula C21H31BrO2 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-bromo-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-bromo-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 74034635 |
| Molecular Formula | C21H31BrO2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-bromo-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(C(=O)CBr)CCC12 |
| InChI | InChI=1S/C21H31BrO2/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h3,14-18,23H,4-12H2,1-2H3 |
| InChIKey | WKOYDRBILYGOJL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|