C32H54O — CID 124917391
(3R,8S,9S,10R,13R,14R,17S)-17-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-3-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 124917391) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14R,17S)-17-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-3-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,8S,9S,10R,13R,14R,17S)-17-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-3-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 124917391 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | (3R,8S,9S,10R,13R,14R,17S)-17-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-3-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCO[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]4CC[C@@H]([C@H](C)/C=C/[C@H](CC)C(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H54O/c1-8-20-33-26-16-18-31(6)25(21-26)12-13-27-29-15-14-28(32(29,7)19-17-30(27)31)23(5)10-11-24(9-2)22(3)4/h10-12,22-24,26-30H,8-9,13-21H2,1-7H3/b11-10+/t23-,24+,26-,27+,28+,29-,30+,31+,32-/m1/s1 |
| InChIKey | KIPSMTPEMGYLOP-NEASUIFCSA-N |
| XLogP | 9.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|