C35H60O2 — CID 67945463
6-[[(3S,10R,13R,17R)-17-[(2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexan-1-ol (PubChem CID 67945463) has the molecular formula C35H60O2 and a molecular weight of 512.86 g/mol. Its IUPAC name is 6-[[(3S,10R,13R,17R)-17-[(2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexan-1-ol.
| Compound Name | 6-[[(3S,10R,13R,17R)-17-[(2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexan-1-ol |
|---|---|
| PubChem CID | 67945463 |
| Molecular Formula | C35H60O2 |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | 6-[[(3S,10R,13R,17R)-17-[(2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexan-1-ol |
| SMILES | CC[C@H](C=C[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OCCCCCCO)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C35H60O2/c1-7-27(25(2)3)13-12-26(4)31-16-17-32-30-15-14-28-24-29(37-23-11-9-8-10-22-36)18-20-34(28,5)33(30)19-21-35(31,32)6/h12-14,25-27,29-33,36H,7-11,15-24H2,1-6H3/t26-,27-,29+,30?,31-,32?,33?,34+,35-/m1/s1 |
| InChIKey | HDUBBBKCALKQMX-ZAFSEGSDSA-N |
| XLogP | 9.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|