C35H61NO3 — CID 124920470
[(3S,5S,8S,9R,10S,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (heptan-4-ylideneamino) carbonate (PubChem CID 124920470) has the molecular formula C35H61NO3 and a molecular weight of 543.88 g/mol. Its IUPAC name is [(3S,5S,8S,9R,10S,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (heptan-4-ylideneamino) carbonate.
| Compound Name | [(3S,5S,8S,9R,10S,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (heptan-4-ylideneamino) carbonate |
|---|---|
| PubChem CID | 124920470 |
| Molecular Formula | C35H61NO3 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 543.47 |
| IUPAC Name | [(3S,5S,8S,9R,10S,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (heptan-4-ylideneamino) carbonate |
| SMILES | CCCC(CCC)=NOC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]2CC[C@@]2(C)[C@@H]3CC[C@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H61NO3/c1-8-11-27(12-9-2)36-39-33(37)38-28-19-21-34(6)26(23-28)15-16-29-31-18-17-30(25(5)14-10-13-24(3)4)35(31,7)22-20-32(29)34/h24-26,28-32H,8-23H2,1-7H3/t25-,26+,28+,29-,30+,31-,32-,34+,35-/m1/s1 |
| InChIKey | ZHXKNRMWQGNQJU-JTSFUEKUSA-N |
| XLogP | 10.59 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|