C26H16Cl8N2O4 — CID 124922900
(3aR,9aR)-2-[2-[(3aR,9aR)-5,6,7,8-tetrachloro-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl]ethyl]-5,6,7,8-tetrachloro-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione (PubChem CID 124922900) has the molecular formula C26H16Cl8N2O4 and a molecular weight of 704.05 g/mol. Its IUPAC name is (3aR,9aR)-2-[2-[(3aR,9aR)-5,6,7,8-tetrachloro-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl]ethyl]-5,6,7,8-tetrachloro-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione.
| Compound Name | (3aR,9aR)-2-[2-[(3aR,9aR)-5,6,7,8-tetrachloro-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl]ethyl]-5,6,7,8-tetrachloro-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 124922900 |
| Molecular Formula | C26H16Cl8N2O4 |
| Molecular Weight | 704.05 g/mol |
| Exact Mass | 699.86 |
| IUPAC Name | (3aR,9aR)-2-[2-[(3aR,9aR)-5,6,7,8-tetrachloro-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl]ethyl]-5,6,7,8-tetrachloro-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione |
| SMILES | O=C1[C@@H]2Cc3c(Cl)c(Cl)c(Cl)c(Cl)c3C[C@H]2C(=O)N1CCN1C(=O)[C@@H]2Cc3c(Cl)c(Cl)c(Cl)c(Cl)c3C[C@H]2C1=O |
| InChI | InChI=1S/C26H16Cl8N2O4/c27-15-7-3-11-12(4-8(7)16(28)20(32)19(15)31)24(38)35(23(11)37)1-2-36-25(39)13-5-9-10(6-14(13)26(36)40)18(30)22(34)21(33)17(9)29/h11-14H,1-6H2/t11-,12-,13-,14-/m1/s1 |
| InChIKey | BETKGGXHLKAQEE-AAVRWANBSA-N |
| XLogP | 7.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.05 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|