C12H18Cl2N2O2 — CID 126476507
5-chloro-2-[2-(dimethylamino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride (PubChem CID 126476507) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 5-chloro-2-[2-(dimethylamino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-chloro-2-[2-(dimethylamino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 126476507 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-chloro-2-[2-(dimethylamino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride |
| SMILES | CN(C)CCN1C(=O)C2CC=C(Cl)CC2C1=O.Cl |
| InChI | InChI=1S/C12H17ClN2O2.ClH/c1-14(2)5-6-15-11(16)9-4-3-8(13)7-10(9)12(15)17;/h3,9-10H,4-7H2,1-2H3;1H |
| InChIKey | LHMJCJMIUSAAPL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|