C10H10ClNO4 — CID 2861802
2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetic acid (PubChem CID 2861802) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetic acid.
| Compound Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 2861802 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)C2CC=C(Cl)CC2C1=O |
| InChI | InChI=1S/C10H10ClNO4/c11-5-1-2-6-7(3-5)10(16)12(9(6)15)4-8(13)14/h1,6-7H,2-4H2,(H,13,14) |
| InChIKey | HFPBBBRKXPTIFX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|