C17H17ClN2O3 — CID 2870948
2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-methylphenyl)acetamide (PubChem CID 2870948) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2870948 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CN1C(=O)C2CC=C(Cl)CC2C1=O |
| InChI | InChI=1S/C17H17ClN2O3/c1-10-4-2-3-5-14(10)19-15(21)9-20-16(22)12-7-6-11(18)8-13(12)17(20)23/h2-6,12-13H,7-9H2,1H3,(H,19,21) |
| InChIKey | MNVZLUWHYVXANC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|