C17H17ClN2O4 — CID 3236089
3-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-hydroxyphenyl)propanamide (PubChem CID 3236089) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-hydroxyphenyl)propanamide.
| Compound Name | 3-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 3236089 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-hydroxyphenyl)propanamide |
| SMILES | O=C(CCN1C(=O)C2CC=C(Cl)CC2C1=O)Nc1ccccc1O |
| InChI | InChI=1S/C17H17ClN2O4/c18-10-5-6-11-12(9-10)17(24)20(16(11)23)8-7-15(22)19-13-3-1-2-4-14(13)21/h1-5,11-12,21H,6-9H2,(H,19,22) |
| InChIKey | GWPVCZBVBBJONV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|