C17H15ClN2O5 — CID 1306176
4-[[2-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]benzoic acid (PubChem CID 1306176) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 4-[[2-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1306176 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-[[2-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(CN1C(=O)[C@H]2CC(Cl)=CC[C@H]2C1=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H15ClN2O5/c18-10-3-6-12-13(7-10)16(23)20(15(12)22)8-14(21)19-11-4-1-9(2-5-11)17(24)25/h1-5,12-13H,6-8H2,(H,19,21)(H,24,25)/t12-,13+/m1/s1 |
| InChIKey | ICFWUFHDPVWIRQ-OLZOCXBDSA-N |
| XLogP | 1.84 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|