C10H9ClNO4- — CID 4100088
2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate (PubChem CID 4100088) has the molecular formula C10H9ClNO4- and a molecular weight of 242.64 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate.
| Compound Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 4100088 |
| Molecular Formula | C10H9ClNO4- |
| Molecular Weight | 242.64 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-(5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
| SMILES | O=C([O-])CN1C(=O)C2CC=C(Cl)CC2C1=O |
| InChI | InChI=1S/C10H10ClNO4/c11-5-1-2-6-7(3-5)10(16)12(9(6)15)4-8(13)14/h1,6-7H,2-4H2,(H,13,14)/p-1 |
| InChIKey | HFPBBBRKXPTIFX-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.64 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|