C24H34O6 — CID 124924737
(1R,2S,3R,4R,7R,9R,10S,11R,12S,13R,14R,17S,19R,20S)-9,19-bis(dimethoxymethyl)-8,18-dioxaoctacyclo[9.9.0.02,9.03,7.04,20.010,14.012,19.013,17]icosane (PubChem CID 124924737) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (1R,2S,3R,4R,7R,9R,10S,11R,12S,13R,14R,17S,19R,20S)-9,19-bis(dimethoxymethyl)-8,18-dioxaoctacyclo[9.9.0.02,9.03,7.04,20.010,14.012,19.013,17]icosane.
| Compound Name | (1R,2S,3R,4R,7R,9R,10S,11R,12S,13R,14R,17S,19R,20S)-9,19-bis(dimethoxymethyl)-8,18-dioxaoctacyclo[9.9.0.02,9.03,7.04,20.010,14.012,19.013,17]icosane |
|---|---|
| PubChem CID | 124924737 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1R,2S,3R,4R,7R,9R,10S,11R,12S,13R,14R,17S,19R,20S)-9,19-bis(dimethoxymethyl)-8,18-dioxaoctacyclo[9.9.0.02,9.03,7.04,20.010,14.012,19.013,17]icosane |
| SMILES | COC(OC)[C@]12O[C@H]3CC[C@@H]4[C@@H]3[C@@H]1[C@@H]1[C@H]3[C@H]5[C@H]6[C@@H](CC[C@H]6O[C@]5(C(OC)OC)[C@@H]41)[C@@H]32 |
| InChI | InChI=1S/C24H34O6/c1-25-21(26-2)23-17-9-5-8-12-14(9)20-15(17)16-18(24(20,30-12)22(27-3)28-4)10-6-7-11(29-23)13(10)19(16)23/h9-22H,5-8H2,1-4H3/t9-,10-,11-,12+,13+,14+,15-,16-,17+,18+,19-,20-,23-,24-/m1/s1 |
| InChIKey | YFVHONRKYHJCFE-JHUNQOOZSA-N |
| XLogP | 2.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|