C21H22O4 — CID 124790030
methyl (1S,2S,5R,8S,9R,10R,11S,12R,13R,14S,15R,19S,20R)-3-oxo-4-oxaoctacyclo[9.8.1.02,10.02,13.05,9.08,12.014,20.015,19]icos-16-ene-13-carboxylate (PubChem CID 124790030) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl (1S,2S,5R,8S,9R,10R,11S,12R,13R,14S,15R,19S,20R)-3-oxo-4-oxaoctacyclo[9.8.1.02,10.02,13.05,9.08,12.014,20.015,19]icos-16-ene-13-carboxylate.
| Compound Name | methyl (1S,2S,5R,8S,9R,10R,11S,12R,13R,14S,15R,19S,20R)-3-oxo-4-oxaoctacyclo[9.8.1.02,10.02,13.05,9.08,12.014,20.015,19]icos-16-ene-13-carboxylate |
|---|---|
| PubChem CID | 124790030 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl (1S,2S,5R,8S,9R,10R,11S,12R,13R,14S,15R,19S,20R)-3-oxo-4-oxaoctacyclo[9.8.1.02,10.02,13.05,9.08,12.014,20.015,19]icos-16-ene-13-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3[C@@H]4CC[C@H]5OC(=O)[C@@]16[C@H]([C@H]3[C@H]1[C@@H]2[C@@H]2C=CC[C@@H]2[C@@H]16)[C@@H]45 |
| InChI | InChI=1S/C21H22O4/c1-24-18(22)20-14-7-3-2-4-8(7)15-12(14)13-16(20)9-5-6-10-11(9)17(13)21(15,20)19(23)25-10/h2-3,7-17H,4-6H2,1H3/t7-,8+,9-,10-,11+,12+,13+,14+,15+,16-,17+,20-,21-/m1/s1 |
| InChIKey | KWNRKCTYBKFLAI-NIUQPRCASA-N |
| XLogP | 2.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|