C15H7ClN2O2 — CID 124927728
4-chloroisoindolo[2,3-a]quinazoline-5,11-dione (PubChem CID 124927728) has the molecular formula C15H7ClN2O2 and a molecular weight of 282.69 g/mol. Its IUPAC name is 4-chloroisoindolo[2,3-a]quinazoline-5,11-dione.
| Compound Name | 4-chloroisoindolo[2,3-a]quinazoline-5,11-dione |
|---|---|
| PubChem CID | 124927728 |
| Molecular Formula | C15H7ClN2O2 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 4-chloroisoindolo[2,3-a]quinazoline-5,11-dione |
| SMILES | O=C1c2ccccc2-c2nc(=O)c3c(Cl)cccc3n21 |
| InChI | InChI=1S/C15H7ClN2O2/c16-10-6-3-7-11-12(10)14(19)17-13-8-4-1-2-5-9(8)15(20)18(11)13/h1-7H |
| InChIKey | SPMQEJWYVBDXFI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |