C21H20N2O2S — CID 51851817
(6R)-6-tert-butyl-3-thia-1,12-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-2(10),4(9),12,14,16,18-hexaene-11,20-dione (PubChem CID 51851817) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (6R)-6-tert-butyl-3-thia-1,12-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-2(10),4(9),12,14,16,18-hexaene-11,20-dione.
| Compound Name | (6R)-6-tert-butyl-3-thia-1,12-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-2(10),4(9),12,14,16,18-hexaene-11,20-dione |
|---|---|
| PubChem CID | 51851817 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (6R)-6-tert-butyl-3-thia-1,12-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-2(10),4(9),12,14,16,18-hexaene-11,20-dione |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc3c2c(=O)nc2n3C(=O)c3ccccc3-2)C1 |
| InChI | InChI=1S/C21H20N2O2S/c1-21(2,3)11-8-9-14-15(10-11)26-20-16(14)18(24)22-17-12-6-4-5-7-13(12)19(25)23(17)20/h4-7,11H,8-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | DVOVHNDMMSNYFK-LLVKDONJSA-N |
| XLogP | 4.28 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |