C21H26N4OS — CID 142735853
7-tert-butyl-2-hydrazinyl-3-(2-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 142735853) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 7-tert-butyl-2-hydrazinyl-3-(2-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-hydrazinyl-3-(2-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142735853 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 7-tert-butyl-2-hydrazinyl-3-(2-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccccc1-n1c(NN)nc2sc3c(c2c1=O)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C21H26N4OS/c1-12-7-5-6-8-15(12)25-19(26)17-14-10-9-13(21(2,3)4)11-16(14)27-18(17)23-20(25)24-22/h5-8,13H,9-11,22H2,1-4H3,(H,23,24) |
| InChIKey | HYAUXMJYAZDHLA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|