C17H20N5OS+ — CID 4294747
5-hydrazinyl-11-methyl-4-(2-methylphenyl)-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 4294747) has the molecular formula C17H20N5OS+ and a molecular weight of 342.45 g/mol. Its IUPAC name is 5-hydrazinyl-11-methyl-4-(2-methylphenyl)-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-hydrazinyl-11-methyl-4-(2-methylphenyl)-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 4294747 |
| Molecular Formula | C17H20N5OS+ |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-hydrazinyl-11-methyl-4-(2-methylphenyl)-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | Cc1ccccc1-n1c(NN)nc2sc3c(c2c1=O)CC[NH+](C)C3 |
| InChI | InChI=1S/C17H19N5OS/c1-10-5-3-4-6-12(10)22-16(23)14-11-7-8-21(2)9-13(11)24-15(14)19-17(22)20-18/h3-6H,7-9,18H2,1-2H3,(H,19,20)/p+1 |
| InChIKey | FMJWSEGRQWLMIL-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|