C22H28N4OS+2 — CID 7831995
3-(2-methylphenyl)-2-(piperazine-1,4-diium-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7831995) has the molecular formula C22H28N4OS+2 and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2-(piperazine-1,4-diium-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-methylphenyl)-2-(piperazine-1,4-diium-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7831995 |
| Molecular Formula | C22H28N4OS+2 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-(2-methylphenyl)-2-(piperazine-1,4-diium-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccccc1-n1c(C[NH+]2CC[NH2+]CC2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C22H26N4OS/c1-15-6-2-4-8-17(15)26-19(14-25-12-10-23-11-13-25)24-21-20(22(26)27)16-7-3-5-9-18(16)28-21/h2,4,6,8,23H,3,5,7,9-14H2,1H3/p+2 |
| InChIKey | ZPYSJNVZZGDHTE-UHFFFAOYSA-P |
| XLogP | 0.60 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |