C19H30N4OS — CID 142735863
7-tert-butyl-2-hydrazinyl-3-(3-methylbutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 142735863) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is 7-tert-butyl-2-hydrazinyl-3-(3-methylbutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-hydrazinyl-3-(3-methylbutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142735863 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 7-tert-butyl-2-hydrazinyl-3-(3-methylbutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)CCn1c(NN)nc2sc3c(c2c1=O)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C19H30N4OS/c1-11(2)8-9-23-17(24)15-13-7-6-12(19(3,4)5)10-14(13)25-16(15)21-18(23)22-20/h11-12H,6-10,20H2,1-5H3,(H,21,22) |
| InChIKey | FRVBHBDJOLQUEP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|