C18H28N4OS — CID 142735856
3-butyl-7-tert-butyl-2-hydrazinyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 142735856) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 3-butyl-7-tert-butyl-2-hydrazinyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-butyl-7-tert-butyl-2-hydrazinyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142735856 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-butyl-7-tert-butyl-2-hydrazinyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCn1c(NN)nc2sc3c(c2c1=O)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C18H28N4OS/c1-5-6-9-22-16(23)14-12-8-7-11(18(2,3)4)10-13(12)24-15(14)20-17(22)21-19/h11H,5-10,19H2,1-4H3,(H,20,21) |
| InChIKey | IPSNBAXFSWNREN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|