C24H36N2OS2 — CID 3832261
7-tert-butyl-2-heptylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3832261) has the molecular formula C24H36N2OS2 and a molecular weight of 432.70 g/mol. Its IUPAC name is 7-tert-butyl-2-heptylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-heptylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3832261 |
| Molecular Formula | C24H36N2OS2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 7-tert-butyl-2-heptylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCCCCCC)nc2sc3c(c2c1=O)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C24H36N2OS2/c1-6-8-9-10-11-15-28-23-25-21-20(22(27)26(23)14-7-2)18-13-12-17(24(3,4)5)16-19(18)29-21/h7,17H,2,6,8-16H2,1,3-5H3 |
| InChIKey | MKOOJJOTJFTPDL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|