C29H40N2O2S2 — CID 18849270
7-tert-butyl-3-(4-methoxyphenyl)-2-octylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 18849270) has the molecular formula C29H40N2O2S2 and a molecular weight of 512.79 g/mol. Its IUPAC name is 7-tert-butyl-3-(4-methoxyphenyl)-2-octylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-3-(4-methoxyphenyl)-2-octylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18849270 |
| Molecular Formula | C29H40N2O2S2 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 7-tert-butyl-3-(4-methoxyphenyl)-2-octylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCSc1nc2sc3c(c2c(=O)n1-c1ccc(OC)cc1)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C29H40N2O2S2/c1-6-7-8-9-10-11-18-34-28-30-26-25(23-17-12-20(29(2,3)4)19-24(23)35-26)27(32)31(28)21-13-15-22(33-5)16-14-21/h13-16,20H,6-12,17-19H2,1-5H3 |
| InChIKey | DSICSYPDFJSAEW-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|