C25H32N2OS2 — CID 4637795
7-tert-butyl-2-butylsulfanyl-3-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4637795) has the molecular formula C25H32N2OS2 and a molecular weight of 440.68 g/mol. Its IUPAC name is 7-tert-butyl-2-butylsulfanyl-3-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-butylsulfanyl-3-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4637795 |
| Molecular Formula | C25H32N2OS2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 7-tert-butyl-2-butylsulfanyl-3-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCSc1nc2sc3c(c2c(=O)n1-c1cccc(C)c1)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C25H32N2OS2/c1-6-7-13-29-24-26-22-21(23(28)27(24)18-10-8-9-16(2)14-18)19-12-11-17(25(3,4)5)15-20(19)30-22/h8-10,14,17H,6-7,11-13,15H2,1-5H3 |
| InChIKey | PTPYUTFVMLPNQL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|