C35H43N3O2S2 — CID 166181014
2-[[7-tert-butyl-3-(2,6-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)propanamide (PubChem CID 166181014) has the molecular formula C35H43N3O2S2 and a molecular weight of 601.88 g/mol. Its IUPAC name is 2-[[7-tert-butyl-3-(2,6-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)propanamide.
| Compound Name | 2-[[7-tert-butyl-3-(2,6-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 166181014 |
| Molecular Formula | C35H43N3O2S2 |
| Molecular Weight | 601.88 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 2-[[7-tert-butyl-3-(2,6-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)propanamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C(C)Sc1nc2sc3c(c2c(=O)n1-c1c(C)cccc1C)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C35H43N3O2S2/c1-19(2)25-15-11-12-20(3)29(25)36-31(39)23(6)41-34-37-32-28(26-17-16-24(35(7,8)9)18-27(26)42-32)33(40)38(34)30-21(4)13-10-14-22(30)5/h10-15,19,23-24H,16-18H2,1-9H3,(H,36,39) |
| InChIKey | PSJPSTBQVQSKKM-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.88 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |