C24H29N3O3S2 — CID 55419217
N-(2,6-dimethylphenyl)-2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide (PubChem CID 55419217) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 55419217 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
| SMILES | COCCn1c(SC(C)C(=O)Nc2c(C)cccc2C)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C24H29N3O3S2/c1-14-8-7-9-15(2)20(14)25-21(28)16(3)31-24-26-22-19(23(29)27(24)12-13-30-4)17-10-5-6-11-18(17)32-22/h7-9,16H,5-6,10-13H2,1-4H3,(H,25,28) |
| InChIKey | NXODIHDVAXBRGO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |