C22H29N5O3S2 — CID 55503025
2-[[3-[3-(dimethylamino)propyl]-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-methyl-1,2-oxazol-5-yl)propanamide (PubChem CID 55503025) has the molecular formula C22H29N5O3S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-[[3-[3-(dimethylamino)propyl]-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-methyl-1,2-oxazol-5-yl)propanamide.
| Compound Name | 2-[[3-[3-(dimethylamino)propyl]-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 55503025 |
| Molecular Formula | C22H29N5O3S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[[3-[3-(dimethylamino)propyl]-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)Sc2nc3sc4c(c3c(=O)n2CCCN(C)C)CCCC4)on1 |
| InChI | InChI=1S/C22H29N5O3S2/c1-13-12-17(30-25-13)23-19(28)14(2)31-22-24-20-18(15-8-5-6-9-16(15)32-20)21(29)27(22)11-7-10-26(3)4/h12,14H,5-11H2,1-4H3,(H,23,28) |
| InChIKey | WJDWZKAMAUGFKQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |