C24H26N4OS2 — CID 2947445
13-tert-butyl-7-phenyl-3-prop-2-enylsulfanyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 2947445) has the molecular formula C24H26N4OS2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 13-tert-butyl-7-phenyl-3-prop-2-enylsulfanyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 13-tert-butyl-7-phenyl-3-prop-2-enylsulfanyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 2947445 |
| Molecular Formula | C24H26N4OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 13-tert-butyl-7-phenyl-3-prop-2-enylsulfanyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | C=CCSc1nnc2n(-c3ccccc3)c(=O)c3c4c(sc3n12)CC(C(C)(C)C)CC4 |
| InChI | InChI=1S/C24H26N4OS2/c1-5-13-30-23-26-25-22-27(16-9-7-6-8-10-16)20(29)19-17-12-11-15(24(2,3)4)14-18(17)31-21(19)28(22)23/h5-10,15H,1,11-14H2,2-4H3 |
| InChIKey | YOBAUEHZSBHTIX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|