C20H20N4OS2 — CID 5113757
3-ethylsulfanyl-11-methyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 5113757) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-ethylsulfanyl-11-methyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 3-ethylsulfanyl-11-methyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 5113757 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-ethylsulfanyl-11-methyl-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | CCSc1nnc2n(-c3ccccc3)c(=O)c3c4c(sc3n12)CCCC4C |
| InChI | InChI=1S/C20H20N4OS2/c1-3-26-20-22-21-19-23(13-9-5-4-6-10-13)17(25)16-15-12(2)8-7-11-14(15)27-18(16)24(19)20/h4-6,9-10,12H,3,7-8,11H2,1-2H3 |
| InChIKey | BKCUNJWZPSZRJN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |