C30H30N6S3 — CID 3892946
3,8-bis(benzylsulfanyl)-16-tert-butyl-19-thia-2,4,5,7,9,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene (PubChem CID 3892946) has the molecular formula C30H30N6S3 and a molecular weight of 570.81 g/mol. Its IUPAC name is 3,8-bis(benzylsulfanyl)-16-tert-butyl-19-thia-2,4,5,7,9,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene.
| Compound Name | 3,8-bis(benzylsulfanyl)-16-tert-butyl-19-thia-2,4,5,7,9,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
|---|---|
| PubChem CID | 3892946 |
| Molecular Formula | C30H30N6S3 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 3,8-bis(benzylsulfanyl)-16-tert-butyl-19-thia-2,4,5,7,9,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
| SMILES | CC(C)(C)C1CCc2c(sc3c2c2nnc(SCc4ccccc4)n2c2nnc(SCc4ccccc4)n32)C1 |
| InChI | InChI=1S/C30H30N6S3/c1-30(2,3)21-14-15-22-23(16-21)39-26-24(22)25-31-33-28(37-17-19-10-6-4-7-11-19)35(25)27-32-34-29(36(26)27)38-18-20-12-8-5-9-13-20/h4-13,21H,14-18H2,1-3H3 |
| InChIKey | SENZRTRITAPCGU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |