C32H46O4 — CID 124937188
[(3R,5S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(2-oxo-6-propan-2-ylpyran-3-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124937188) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is [(3R,5S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(2-oxo-6-propan-2-ylpyran-3-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(2-oxo-6-propan-2-ylpyran-3-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124937188 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [(3R,5S,10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-(2-oxo-6-propan-2-ylpyran-3-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=C(CC[C@@H]2C1(C)C)[C@]1(C)CC[C@@H](c2ccc(C(C)C)oc2=O)[C@]1(C)CC3 |
| InChI | InChI=1S/C32H46O4/c1-19(2)25-11-9-21(28(34)36-25)22-13-17-32(8)24-10-12-26-29(4,5)27(35-20(3)33)15-16-30(26,6)23(24)14-18-31(22,32)7/h9,11,19,22,26-27H,10,12-18H2,1-8H3/t22-,26+,27+,30+,31-,32-/m0/s1 |
| InChIKey | HDMYAZKAEKOUTB-YTPNVTDISA-N |
| XLogP | 7.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|