C24H39BO3 — CID 124937601
bis[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl] [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl borate (PubChem CID 124937601) has the molecular formula C24H39BO3 and a molecular weight of 386.39 g/mol. Its IUPAC name is bis[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl] [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl borate.
| Compound Name | bis[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl] [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl borate |
|---|---|
| PubChem CID | 124937601 |
| Molecular Formula | C24H39BO3 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | bis[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl] [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl borate |
| SMILES | C1C[C@H]2C[C@H]1C[C@H]2COB(OC[C@@H]1C[C@H]2CC[C@H]1C2)OC[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C24H39BO3/c1-4-19-7-16(1)10-22(19)13-26-25(27-14-23-11-17-2-5-20(23)8-17)28-15-24-12-18-3-6-21(24)9-18/h16-24H,1-15H2/t16-,17-,18-,19-,20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | VHFSLBYLDULHFW-SNVSEMBOSA-N |
| XLogP | 5.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|