About [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone (PubChem CID 124938424) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone |
| PubChem CID | 124938424 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone |
| SMILES | Cc1nc(-c2ccc(F)cc2)ccc1C(=O)N1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C19H21FN2O2/c1-12-10-22(11-13(2)24-12)19(23)17-8-9-18(21-14(17)3)15-4-6-16(20)7-5-15/h4-9,12-13H,10-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | QEBFNIQKTLLSMO-CHWSQXEVSA-N |
| XLogP | 3.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone?
The IUPAC name of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone (CID 124938424) is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone.
What is the SMILES notation for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone?
The canonical SMILES for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone is Cc1nc(-c2ccc(F)cc2)ccc1C(=O)N1C[C@@H](C)O[C@H](C)C1.
What is the InChIKey of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone?
The InChIKey is QEBFNIQKTLLSMO-CHWSQXEVSA-N. The full InChI is InChI=1S/C19H21FN2O2/c1-12-10-22(11-13(2)24-12)19(23)17-8-9-18(21-14(17)3)15-4-6-16(20)7-5-15/h4-9,12-13H,10-11H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone?
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone has a molecular weight of 328.39 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]methanone is sourced from PubChem (CID 124938424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).