C16H14ClFN2O — CID 167809516
(6-chloro-2-methyl-3-pyridinyl)-[3-(4-fluorophenyl)azetidin-1-yl]methanone (PubChem CID 167809516) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is (6-chloro-2-methyl-3-pyridinyl)-[3-(4-fluorophenyl)azetidin-1-yl]methanone.
| Compound Name | (6-chloro-2-methyl-3-pyridinyl)-[3-(4-fluorophenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 167809516 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (6-chloro-2-methyl-3-pyridinyl)-[3-(4-fluorophenyl)azetidin-1-yl]methanone |
| SMILES | Cc1nc(Cl)ccc1C(=O)N1CC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H14ClFN2O/c1-10-14(6-7-15(17)19-10)16(21)20-8-12(9-20)11-2-4-13(18)5-3-11/h2-7,12H,8-9H2,1H3 |
| InChIKey | VRPJWWCDCROFAI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|