C18H27N3O3 — CID 124940245
(2R)-4-(3-methoxypropanoyl)-N-methyl-1-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 124940245) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-4-(3-methoxypropanoyl)-N-methyl-1-(2-phenylethyl)piperazine-2-carboxamide.
| Compound Name | (2R)-4-(3-methoxypropanoyl)-N-methyl-1-(2-phenylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124940245 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (2R)-4-(3-methoxypropanoyl)-N-methyl-1-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(C(=O)CCOC)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C18H27N3O3/c1-19-18(23)16-14-21(17(22)9-13-24-2)12-11-20(16)10-8-15-6-4-3-5-7-15/h3-7,16H,8-14H2,1-2H3,(H,19,23)/t16-/m1/s1 |
| InChIKey | AEZNJQPBSOVKFB-MRXNPFEDSA-N |
| XLogP | 0.52 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |