C20H25N5O2 — CID 125025072
(2R)-N-methyl-4-(4-methylpyrimidine-5-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 125025072) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2R)-N-methyl-4-(4-methylpyrimidine-5-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide.
| Compound Name | (2R)-N-methyl-4-(4-methylpyrimidine-5-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 125025072 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R)-N-methyl-4-(4-methylpyrimidine-5-carbonyl)-1-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(C(=O)c2cncnc2C)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C20H25N5O2/c1-15-17(12-22-14-23-15)20(27)25-11-10-24(18(13-25)19(26)21-2)9-8-16-6-4-3-5-7-16/h3-7,12,14,18H,8-11,13H2,1-2H3,(H,21,26)/t18-/m1/s1 |
| InChIKey | ZKABFTOPBGWSBC-GOSISDBHSA-N |
| XLogP | 0.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |