C19H23N5 — CID 124941136
1-methyl-2-[[(3S)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]methyl]benzimidazole (PubChem CID 124941136) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-methyl-2-[[(3S)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]methyl]benzimidazole.
| Compound Name | 1-methyl-2-[[(3S)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 124941136 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-methyl-2-[[(3S)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]methyl]benzimidazole |
| SMILES | Cc1cncc([C@H]2CCCN(Cc3nc4ccccc4n3C)C2)n1 |
| InChI | InChI=1S/C19H23N5/c1-14-10-20-11-17(21-14)15-6-5-9-24(12-15)13-19-22-16-7-3-4-8-18(16)23(19)2/h3-4,7-8,10-11,15H,5-6,9,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | ALACQZCNEFRFFJ-HNNXBMFYSA-N |
| XLogP | 3.05 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |