C18H23N5 — CID 71926955
1-methyl-2-[[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methyl]benzimidazole (PubChem CID 71926955) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-methyl-2-[[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methyl]benzimidazole.
| Compound Name | 1-methyl-2-[[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 71926955 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-methyl-2-[[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methyl]benzimidazole |
| SMILES | Cc1cc(C2CCCN(Cc3nc4ccccc4n3C)C2)n[nH]1 |
| InChI | InChI=1S/C18H23N5/c1-13-10-16(21-20-13)14-6-5-9-23(11-14)12-18-19-15-7-3-4-8-17(15)22(18)2/h3-4,7-8,10,14H,5-6,9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | YFPNCGAXKPFFTI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |